C24H32O4Si — CID 134945356
2-[(2R,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-methyl-1,3-dioxan-4-yl]acetaldehyde (PubChem CID 134945356) has the molecular formula C24H32O4Si and a molecular weight of 412.60 g/mol. Its IUPAC name is 2-[(2R,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-methyl-1,3-dioxan-4-yl]acetaldehyde.
| Compound Name | 2-[(2R,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-methyl-1,3-dioxan-4-yl]acetaldehyde |
|---|---|
| PubChem CID | 134945356 |
| Molecular Formula | C24H32O4Si |
| Molecular Weight | 412.60 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | 2-[(2R,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-methyl-1,3-dioxan-4-yl]acetaldehyde |
| SMILES | C[C@@H]1OC(CC=O)C[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O1 |
| InChI | InChI=1S/C24H32O4Si/c1-19-27-20(15-16-25)17-21(28-19)18-26-29(24(2,3)4,22-11-7-5-8-12-22)23-13-9-6-10-14-23/h5-14,16,19-21H,15,17-18H2,1-4H3/t19-,20?,21-/m1/s1 |
| InChIKey | JLDSELODKFXGPR-GIBKCMNESA-N |
| XLogP | 3.67 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.60 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|