C36H60O4Si3 — CID 11193027
2-[(1S,2S,3S,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,5-bis(triethylsilyloxy)cyclopentyl]acetaldehyde (PubChem CID 11193027) has the molecular formula C36H60O4Si3 and a molecular weight of 641.13 g/mol. Its IUPAC name is 2-[(1S,2S,3S,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,5-bis(triethylsilyloxy)cyclopentyl]acetaldehyde.
| Compound Name | 2-[(1S,2S,3S,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,5-bis(triethylsilyloxy)cyclopentyl]acetaldehyde |
|---|---|
| PubChem CID | 11193027 |
| Molecular Formula | C36H60O4Si3 |
| Molecular Weight | 641.13 g/mol |
| Exact Mass | 640.38 |
| IUPAC Name | 2-[(1S,2S,3S,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,5-bis(triethylsilyloxy)cyclopentyl]acetaldehyde |
| SMILES | CC[Si](CC)(CC)O[C@H]1C[C@@H](O[Si](CC)(CC)CC)[C@@H](CC=O)[C@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C36H60O4Si3/c1-10-41(11-2,12-3)39-34-28-35(40-42(13-4,14-5)15-6)33(32(34)26-27-37)29-38-43(36(7,8)9,30-22-18-16-19-23-30)31-24-20-17-21-25-31/h16-25,27,32-35H,10-15,26,28-29H2,1-9H3/t32-,33+,34+,35-/m0/s1 |
| InChIKey | TWJRRUKOPZIKKO-FLLNZLDLSA-N |
| XLogP | 8.57 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.13 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|