C44H52O5Si — CID 101122663
[(1R,2R,3R,4S)-4-benzoyloxy-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-[(Z)-oct-2-enyl]cyclopentyl] benzoate (PubChem CID 101122663) has the molecular formula C44H52O5Si and a molecular weight of 688.98 g/mol. Its IUPAC name is [(1R,2R,3R,4S)-4-benzoyloxy-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-[(Z)-oct-2-enyl]cyclopentyl] benzoate.
| Compound Name | [(1R,2R,3R,4S)-4-benzoyloxy-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-[(Z)-oct-2-enyl]cyclopentyl] benzoate |
|---|---|
| PubChem CID | 101122663 |
| Molecular Formula | C44H52O5Si |
| Molecular Weight | 688.98 g/mol |
| Exact Mass | 688.36 |
| IUPAC Name | [(1R,2R,3R,4S)-4-benzoyloxy-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-[(Z)-oct-2-enyl]cyclopentyl] benzoate |
| SMILES | CCCCC/C=C\C[C@@H]1[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H](OC(=O)c2ccccc2)C[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C44H52O5Si/c1-5-6-7-8-9-22-31-38-39(33-47-50(44(2,3)4,36-27-18-12-19-28-36)37-29-20-13-21-30-37)41(49-43(46)35-25-16-11-17-26-35)32-40(38)48-42(45)34-23-14-10-15-24-34/h9-30,38-41H,5-8,31-33H2,1-4H3/b22-9-/t38-,39+,40-,41+/m1/s1 |
| InChIKey | KJSVVRQGDWAVSU-XMQOLOOZSA-N |
| XLogP | 9.18 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.98 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|