C41H52O5Si — CID 10556244
[(1R,2R,3aR,5S,6aS)-1-[(E,1R)-1-acetyloxyoct-2-enyl]-5-[tert-butyl(diphenyl)silyl]oxy-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl] benzoate (PubChem CID 10556244) has the molecular formula C41H52O5Si and a molecular weight of 652.95 g/mol. Its IUPAC name is [(1R,2R,3aR,5S,6aS)-1-[(E,1R)-1-acetyloxyoct-2-enyl]-5-[tert-butyl(diphenyl)silyl]oxy-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl] benzoate.
| Compound Name | [(1R,2R,3aR,5S,6aS)-1-[(E,1R)-1-acetyloxyoct-2-enyl]-5-[tert-butyl(diphenyl)silyl]oxy-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl] benzoate |
|---|---|
| PubChem CID | 10556244 |
| Molecular Formula | C41H52O5Si |
| Molecular Weight | 652.95 g/mol |
| Exact Mass | 652.36 |
| IUPAC Name | [(1R,2R,3aR,5S,6aS)-1-[(E,1R)-1-acetyloxyoct-2-enyl]-5-[tert-butyl(diphenyl)silyl]oxy-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl] benzoate |
| SMILES | CCCCC/C=C/[C@@H](OC(C)=O)[C@@H]1[C@H]2C[C@@H](O[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)C[C@H]2C[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C41H52O5Si/c1-6-7-8-9-19-26-37(44-30(2)42)39-36-29-33(27-32(36)28-38(39)45-40(43)31-20-13-10-14-21-31)46-47(41(3,4)5,34-22-15-11-16-23-34)35-24-17-12-18-25-35/h10-26,32-33,36-39H,6-9,27-29H2,1-5H3/b26-19+/t32-,33-,36-,37+,38+,39-/m0/s1 |
| InChIKey | VUIZIKZRKPJLSJ-UMJDZPDMSA-N |
| XLogP | 8.27 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.95 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|