C37H50O4Si — CID 10555339
[(1S,2R,4R)-4-[tert-butyl(diphenyl)silyl]oxy-2-[(1E,3E,5E)-3-methyltrideca-1,3,5-trienyl]cyclopentyl] 2-oxoacetate (PubChem CID 10555339) has the molecular formula C37H50O4Si and a molecular weight of 586.89 g/mol. Its IUPAC name is [(1S,2R,4R)-4-[tert-butyl(diphenyl)silyl]oxy-2-[(1E,3E,5E)-3-methyltrideca-1,3,5-trienyl]cyclopentyl] 2-oxoacetate.
| Compound Name | [(1S,2R,4R)-4-[tert-butyl(diphenyl)silyl]oxy-2-[(1E,3E,5E)-3-methyltrideca-1,3,5-trienyl]cyclopentyl] 2-oxoacetate |
|---|---|
| PubChem CID | 10555339 |
| Molecular Formula | C37H50O4Si |
| Molecular Weight | 586.89 g/mol |
| Exact Mass | 586.35 |
| IUPAC Name | [(1S,2R,4R)-4-[tert-butyl(diphenyl)silyl]oxy-2-[(1E,3E,5E)-3-methyltrideca-1,3,5-trienyl]cyclopentyl] 2-oxoacetate |
| SMILES | CCCCCCC/C=C/C=C(C)/C=C/[C@H]1C[C@@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C[C@@H]1OC(=O)C=O |
| InChI | InChI=1S/C37H50O4Si/c1-6-7-8-9-10-11-12-15-20-30(2)25-26-31-27-32(28-35(31)40-36(39)29-38)41-42(37(3,4)5,33-21-16-13-17-22-33)34-23-18-14-19-24-34/h12-26,29,31-32,35H,6-11,27-28H2,1-5H3/b15-12+,26-25+,30-20+/t31-,32+,35-/m0/s1 |
| InChIKey | WFCIHPFFICHGGB-HXZHYQNTSA-N |
| XLogP | 7.87 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.89 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|