C55H74O4Si2 — CID 68868182
methyl 7-[(1R,2S,5R)-5-[tert-butyl(diphenyl)silyl]oxy-2-[3-[tert-butyl(diphenyl)silyl]oxy-3-methyloct-1-enyl]-3-methylidenecyclopentyl]hept-5-enoate (PubChem CID 68868182) has the molecular formula C55H74O4Si2 and a molecular weight of 855.37 g/mol. Its IUPAC name is methyl 7-[(1R,2S,5R)-5-[tert-butyl(diphenyl)silyl]oxy-2-[3-[tert-butyl(diphenyl)silyl]oxy-3-methyloct-1-enyl]-3-methylidenecyclopentyl]hept-5-enoate.
| Compound Name | methyl 7-[(1R,2S,5R)-5-[tert-butyl(diphenyl)silyl]oxy-2-[3-[tert-butyl(diphenyl)silyl]oxy-3-methyloct-1-enyl]-3-methylidenecyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 68868182 |
| Molecular Formula | C55H74O4Si2 |
| Molecular Weight | 855.37 g/mol |
| Exact Mass | 854.51 |
| IUPAC Name | methyl 7-[(1R,2S,5R)-5-[tert-butyl(diphenyl)silyl]oxy-2-[3-[tert-butyl(diphenyl)silyl]oxy-3-methyloct-1-enyl]-3-methylidenecyclopentyl]hept-5-enoate |
| SMILES | C=C1C[C@@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H](CC=CCCCC(=O)OC)[C@@H]1C=CC(C)(CCCCC)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C55H74O4Si2/c1-11-12-29-41-55(9,59-61(54(6,7)8,47-34-23-17-24-35-47)48-36-25-18-26-37-48)42-40-49-44(2)43-51(50(49)38-27-13-14-28-39-52(56)57-10)58-60(53(3,4)5,45-30-19-15-20-31-45)46-32-21-16-22-33-46/h13,15-27,30-37,40,42,49-51H,2,11-12,14,28-29,38-39,41,43H2,1,3-10H3/t49-,50-,51-,55?/m1/s1 |
| InChIKey | NXFSPCJAOGSVMR-WLPJTGNQSA-N |
| XLogP | 11.89 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 855.37 |
| LogP ≤ 5 | 11.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|