C46H56O5SSi — CID 67000745
methyl 7-[(1R,2R,5S)-2-[3-(1-benzothiophen-2-yl)-3-[tert-butyl(diphenyl)silyl]oxyprop-1-enyl]-3-methylidene-5-(oxan-2-yloxy)cyclopentyl]hept-5-enoate (PubChem CID 67000745) has the molecular formula C46H56O5SSi and a molecular weight of 749.10 g/mol. Its IUPAC name is methyl 7-[(1R,2R,5S)-2-[3-(1-benzothiophen-2-yl)-3-[tert-butyl(diphenyl)silyl]oxyprop-1-enyl]-3-methylidene-5-(oxan-2-yloxy)cyclopentyl]hept-5-enoate.
| Compound Name | methyl 7-[(1R,2R,5S)-2-[3-(1-benzothiophen-2-yl)-3-[tert-butyl(diphenyl)silyl]oxyprop-1-enyl]-3-methylidene-5-(oxan-2-yloxy)cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 67000745 |
| Molecular Formula | C46H56O5SSi |
| Molecular Weight | 749.10 g/mol |
| Exact Mass | 748.36 |
| IUPAC Name | methyl 7-[(1R,2R,5S)-2-[3-(1-benzothiophen-2-yl)-3-[tert-butyl(diphenyl)silyl]oxyprop-1-enyl]-3-methylidene-5-(oxan-2-yloxy)cyclopentyl]hept-5-enoate |
| SMILES | C=C1C[C@H](OC2CCCCO2)[C@H](CC=CCCCC(=O)OC)[C@H]1C=CC(O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)c1cc2ccccc2s1 |
| InChI | InChI=1S/C46H56O5SSi/c1-34-32-41(50-45-28-18-19-31-49-45)39(25-14-6-7-15-27-44(47)48-5)38(34)29-30-40(43-33-35-20-16-17-26-42(35)52-43)51-53(46(2,3)4,36-21-10-8-11-22-36)37-23-12-9-13-24-37/h6,8-14,16-17,20-24,26,29-30,33,38-41,45H,1,7,15,18-19,25,27-28,31-32H2,2-5H3/t38-,39+,40?,41-,45?/m0/s1 |
| InChIKey | IOAUEYBAXFACEG-ZQGMBOEKSA-N |
| XLogP | 10.47 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.10 |
| LogP ≤ 5 | 10.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|