C29H37NO7S2 — CID 70670706
(Z)-7-[(1R,2R,3R)-2-[(E,3R)-3-(1-benzothiophen-2-yl)-3-hydroxyprop-1-enyl]-3-(oxan-2-yloxy)-5-oxocyclopentyl]-N-methylsulfonylhept-5-enamide (PubChem CID 70670706) has the molecular formula C29H37NO7S2 and a molecular weight of 575.75 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,3R)-2-[(E,3R)-3-(1-benzothiophen-2-yl)-3-hydroxyprop-1-enyl]-3-(oxan-2-yloxy)-5-oxocyclopentyl]-N-methylsulfonylhept-5-enamide.
| Compound Name | (Z)-7-[(1R,2R,3R)-2-[(E,3R)-3-(1-benzothiophen-2-yl)-3-hydroxyprop-1-enyl]-3-(oxan-2-yloxy)-5-oxocyclopentyl]-N-methylsulfonylhept-5-enamide |
|---|---|
| PubChem CID | 70670706 |
| Molecular Formula | C29H37NO7S2 |
| Molecular Weight | 575.75 g/mol |
| Exact Mass | 575.20 |
| IUPAC Name | (Z)-7-[(1R,2R,3R)-2-[(E,3R)-3-(1-benzothiophen-2-yl)-3-hydroxyprop-1-enyl]-3-(oxan-2-yloxy)-5-oxocyclopentyl]-N-methylsulfonylhept-5-enamide |
| SMILES | CS(=O)(=O)NC(=O)CCC/C=C\C[C@H]1C(=O)C[C@@H](OC2CCCCO2)[C@@H]1/C=C/[C@@H](O)c1cc2ccccc2s1 |
| InChI | InChI=1S/C29H37NO7S2/c1-39(34,35)30-28(33)13-5-3-2-4-11-21-22(25(19-24(21)32)37-29-14-8-9-17-36-29)15-16-23(31)27-18-20-10-6-7-12-26(20)38-27/h2,4,6-7,10,12,15-16,18,21-23,25,29,31H,3,5,8-9,11,13-14,17,19H2,1H3,(H,30,33)/b4-2-,16-15+/t21-,22-,23-,25-,29?/m1/s1 |
| InChIKey | UCNAPASEIDAOTM-KFZQPUALSA-N |
| XLogP | 4.80 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.75 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|