C25H30O5S — CID 70806259
(Z)-7-[(1R,3R)-2-[(E)-4-(1-benzothiophen-2-yl)-3-hydroxybut-1-enyl]-3-(hydroxymethyl)-5-oxocyclopentyl]hept-5-enoic acid (PubChem CID 70806259) has the molecular formula C25H30O5S and a molecular weight of 442.58 g/mol. Its IUPAC name is (Z)-7-[(1R,3R)-2-[(E)-4-(1-benzothiophen-2-yl)-3-hydroxybut-1-enyl]-3-(hydroxymethyl)-5-oxocyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,3R)-2-[(E)-4-(1-benzothiophen-2-yl)-3-hydroxybut-1-enyl]-3-(hydroxymethyl)-5-oxocyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 70806259 |
| Molecular Formula | C25H30O5S |
| Molecular Weight | 442.58 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | (Z)-7-[(1R,3R)-2-[(E)-4-(1-benzothiophen-2-yl)-3-hydroxybut-1-enyl]-3-(hydroxymethyl)-5-oxocyclopentyl]hept-5-enoic acid |
| SMILES | O=C(O)CCC/C=C\C[C@H]1C(=O)C[C@@H](CO)C1/C=C/C(O)Cc1cc2ccccc2s1 |
| InChI | InChI=1S/C25H30O5S/c26-16-18-14-23(28)22(8-3-1-2-4-10-25(29)30)21(18)12-11-19(27)15-20-13-17-7-5-6-9-24(17)31-20/h1,3,5-7,9,11-13,18-19,21-22,26-27H,2,4,8,10,14-16H2,(H,29,30)/b3-1-,12-11+/t18-,19?,21?,22+/m0/s1 |
| InChIKey | JJBUTALXCBUBOQ-HDRQSZAMSA-N |
| XLogP | 4.38 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.58 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|