C23H27FO4S — CID 67000507
(Z)-7-[(1R,2R,3S)-2-[(3R)-3-(1-benzothiophen-2-yl)-3-hydroxypropyl]-3-fluoro-5-oxocyclopentyl]hept-5-enoic acid (PubChem CID 67000507) has the molecular formula C23H27FO4S and a molecular weight of 418.53 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,3S)-2-[(3R)-3-(1-benzothiophen-2-yl)-3-hydroxypropyl]-3-fluoro-5-oxocyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2R,3S)-2-[(3R)-3-(1-benzothiophen-2-yl)-3-hydroxypropyl]-3-fluoro-5-oxocyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 67000507 |
| Molecular Formula | C23H27FO4S |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | (Z)-7-[(1R,2R,3S)-2-[(3R)-3-(1-benzothiophen-2-yl)-3-hydroxypropyl]-3-fluoro-5-oxocyclopentyl]hept-5-enoic acid |
| SMILES | O=C(O)CCC/C=C\C[C@H]1C(=O)C[C@H](F)[C@@H]1CC[C@@H](O)c1cc2ccccc2s1 |
| InChI | InChI=1S/C23H27FO4S/c24-18-14-20(26)17(8-3-1-2-4-10-23(27)28)16(18)11-12-19(25)22-13-15-7-5-6-9-21(15)29-22/h1,3,5-7,9,13,16-19,25H,2,4,8,10-12,14H2,(H,27,28)/b3-1-/t16-,17-,18+,19-/m1/s1 |
| InChIKey | VKWFXKPHWXJZNB-UMQUAKBUSA-N |
| XLogP | 5.46 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|