C23H28O5S — CID 67000347
7-[(1R,2R,3R)-2-[3-(1-benzothiophen-2-yl)-3-hydroxypropyl]-3-hydroxy-5-oxocyclopentyl]hept-5-enoic acid (PubChem CID 67000347) has the molecular formula C23H28O5S and a molecular weight of 416.54 g/mol. Its IUPAC name is 7-[(1R,2R,3R)-2-[3-(1-benzothiophen-2-yl)-3-hydroxypropyl]-3-hydroxy-5-oxocyclopentyl]hept-5-enoic acid.
| Compound Name | 7-[(1R,2R,3R)-2-[3-(1-benzothiophen-2-yl)-3-hydroxypropyl]-3-hydroxy-5-oxocyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 67000347 |
| Molecular Formula | C23H28O5S |
| Molecular Weight | 416.54 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | 7-[(1R,2R,3R)-2-[3-(1-benzothiophen-2-yl)-3-hydroxypropyl]-3-hydroxy-5-oxocyclopentyl]hept-5-enoic acid |
| SMILES | O=C(O)CCCC=CC[C@H]1C(=O)C[C@@H](O)[C@@H]1CCC(O)c1cc2ccccc2s1 |
| InChI | InChI=1S/C23H28O5S/c24-18(22-13-15-7-5-6-9-21(15)29-22)12-11-17-16(19(25)14-20(17)26)8-3-1-2-4-10-23(27)28/h1,3,5-7,9,13,16-18,20,24,26H,2,4,8,10-12,14H2,(H,27,28)/t16-,17-,18?,20-/m1/s1 |
| InChIKey | IJPVAAORJYOJPD-VPZFWCOMSA-N |
| XLogP | 4.48 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.54 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|