C25H34O5S — CID 67000883
7-[(1R,2R,5S)-2-[(3R)-5-(1-benzothiophen-2-yl)-3-hydroxypentyl]-5-hydroxy-3-oxocyclopentyl]heptanoic acid (PubChem CID 67000883) has the molecular formula C25H34O5S and a molecular weight of 446.61 g/mol. Its IUPAC name is 7-[(1R,2R,5S)-2-[(3R)-5-(1-benzothiophen-2-yl)-3-hydroxypentyl]-5-hydroxy-3-oxocyclopentyl]heptanoic acid.
| Compound Name | 7-[(1R,2R,5S)-2-[(3R)-5-(1-benzothiophen-2-yl)-3-hydroxypentyl]-5-hydroxy-3-oxocyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 67000883 |
| Molecular Formula | C25H34O5S |
| Molecular Weight | 446.61 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | 7-[(1R,2R,5S)-2-[(3R)-5-(1-benzothiophen-2-yl)-3-hydroxypentyl]-5-hydroxy-3-oxocyclopentyl]heptanoic acid |
| SMILES | O=C(O)CCCCCC[C@H]1[C@@H](O)CC(=O)[C@@H]1CC[C@@H](O)CCc1cc2ccccc2s1 |
| InChI | InChI=1S/C25H34O5S/c26-18(11-13-19-15-17-7-5-6-9-24(17)31-19)12-14-21-20(22(27)16-23(21)28)8-3-1-2-4-10-25(29)30/h5-7,9,15,18,20-22,26-27H,1-4,8,10-14,16H2,(H,29,30)/t18-,20+,21+,22-/m0/s1 |
| InChIKey | GZUHECZBUZYUOA-PDGJWGCVSA-N |
| XLogP | 4.97 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.61 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|