C22H35NO6 — CID 172961845
7-[(1R,3Z,5S)-2-[(3S)-6-(furan-2-yl)-3-hydroxyhexyl]-5-hydroxy-3-hydroxyiminocyclopentyl]heptanoic acid (PubChem CID 172961845) has the molecular formula C22H35NO6 and a molecular weight of 409.52 g/mol. Its IUPAC name is 7-[(1R,3Z,5S)-2-[(3S)-6-(furan-2-yl)-3-hydroxyhexyl]-5-hydroxy-3-hydroxyiminocyclopentyl]heptanoic acid.
| Compound Name | 7-[(1R,3Z,5S)-2-[(3S)-6-(furan-2-yl)-3-hydroxyhexyl]-5-hydroxy-3-hydroxyiminocyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 172961845 |
| Molecular Formula | C22H35NO6 |
| Molecular Weight | 409.52 g/mol |
| Exact Mass | 409.25 |
| IUPAC Name | 7-[(1R,3Z,5S)-2-[(3S)-6-(furan-2-yl)-3-hydroxyhexyl]-5-hydroxy-3-hydroxyiminocyclopentyl]heptanoic acid |
| SMILES | O=C(O)CCCCCC[C@@H]1C(CC[C@@H](O)CCCc2ccco2)/C(=N\O)C[C@@H]1O |
| InChI | InChI=1S/C22H35NO6/c24-16(7-5-8-17-9-6-14-29-17)12-13-18-19(21(25)15-20(18)23-28)10-3-1-2-4-11-22(26)27/h6,9,14,16,18-19,21,24-25,28H,1-5,7-8,10-13,15H2,(H,26,27)/b23-20-/t16-,18?,19+,21-/m0/s1 |
| InChIKey | SAHNKTWDHDCHHB-ODQLMJPDSA-N |
| XLogP | 4.00 |
| TPSA | 123.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.52 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|