C25H37F2NO5 — CID 22085174
7-[(3E)-2-[5-(3,5-difluorophenyl)-3-hydroxypentyl]-3-ethoxyimino-5-hydroxycyclopentyl]heptanoic acid (PubChem CID 22085174) has the molecular formula C25H37F2NO5 and a molecular weight of 469.57 g/mol. Its IUPAC name is 7-[(3E)-2-[5-(3,5-difluorophenyl)-3-hydroxypentyl]-3-ethoxyimino-5-hydroxycyclopentyl]heptanoic acid.
| Compound Name | 7-[(3E)-2-[5-(3,5-difluorophenyl)-3-hydroxypentyl]-3-ethoxyimino-5-hydroxycyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 22085174 |
| Molecular Formula | C25H37F2NO5 |
| Molecular Weight | 469.57 g/mol |
| Exact Mass | 469.26 |
| IUPAC Name | 7-[(3E)-2-[5-(3,5-difluorophenyl)-3-hydroxypentyl]-3-ethoxyimino-5-hydroxycyclopentyl]heptanoic acid |
| SMILES | CCO/N=C1\CC(O)C(CCCCCCC(=O)O)C1CCC(O)CCc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C25H37F2NO5/c1-2-33-28-23-16-24(30)22(7-5-3-4-6-8-25(31)32)21(23)12-11-20(29)10-9-17-13-18(26)15-19(27)14-17/h13-15,20-22,24,29-30H,2-12,16H2,1H3,(H,31,32)/b28-23+ |
| InChIKey | GOLMTAUUAZRKGL-WEMUOSSPSA-N |
| XLogP | 4.85 |
| TPSA | 99.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.57 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|