C25H38FNO5 — CID 58654676
7-[(1R,2R,3Z,5S)-2-[(3S)-6-(2-fluorophenyl)-3-hydroxyhexyl]-5-hydroxy-3-methoxyiminocyclopentyl]heptanoic acid (PubChem CID 58654676) has the molecular formula C25H38FNO5 and a molecular weight of 451.58 g/mol. Its IUPAC name is 7-[(1R,2R,3Z,5S)-2-[(3S)-6-(2-fluorophenyl)-3-hydroxyhexyl]-5-hydroxy-3-methoxyiminocyclopentyl]heptanoic acid.
| Compound Name | 7-[(1R,2R,3Z,5S)-2-[(3S)-6-(2-fluorophenyl)-3-hydroxyhexyl]-5-hydroxy-3-methoxyiminocyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 58654676 |
| Molecular Formula | C25H38FNO5 |
| Molecular Weight | 451.58 g/mol |
| Exact Mass | 451.27 |
| IUPAC Name | 7-[(1R,2R,3Z,5S)-2-[(3S)-6-(2-fluorophenyl)-3-hydroxyhexyl]-5-hydroxy-3-methoxyiminocyclopentyl]heptanoic acid |
| SMILES | CO/N=C1/C[C@H](O)[C@H](CCCCCCC(=O)O)[C@H]1CC[C@@H](O)CCCc1ccccc1F |
| InChI | InChI=1S/C25H38FNO5/c1-32-27-23-17-24(29)21(12-4-2-3-5-14-25(30)31)20(23)16-15-19(28)11-8-10-18-9-6-7-13-22(18)26/h6-7,9,13,19-21,24,28-29H,2-5,8,10-12,14-17H2,1H3,(H,30,31)/b27-23-/t19-,20+,21+,24-/m0/s1 |
| InChIKey | TZPLGOLFKQTHBY-CZAHJHIESA-N |
| XLogP | 4.71 |
| TPSA | 99.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.58 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|