C24H36FNO5 — CID 22085182
7-[(3Z)-2-[6-(2-fluorophenyl)-3-hydroxyhexyl]-5-hydroxy-3-hydroxyiminocyclopentyl]heptanoic acid (PubChem CID 22085182) has the molecular formula C24H36FNO5 and a molecular weight of 437.55 g/mol. Its IUPAC name is 7-[(3Z)-2-[6-(2-fluorophenyl)-3-hydroxyhexyl]-5-hydroxy-3-hydroxyiminocyclopentyl]heptanoic acid.
| Compound Name | 7-[(3Z)-2-[6-(2-fluorophenyl)-3-hydroxyhexyl]-5-hydroxy-3-hydroxyiminocyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 22085182 |
| Molecular Formula | C24H36FNO5 |
| Molecular Weight | 437.55 g/mol |
| Exact Mass | 437.26 |
| IUPAC Name | 7-[(3Z)-2-[6-(2-fluorophenyl)-3-hydroxyhexyl]-5-hydroxy-3-hydroxyiminocyclopentyl]heptanoic acid |
| SMILES | O=C(O)CCCCCCC1C(O)C/C(=N/O)C1CCC(O)CCCc1ccccc1F |
| InChI | InChI=1S/C24H36FNO5/c25-21-12-6-5-8-17(21)9-7-10-18(27)14-15-19-20(23(28)16-22(19)26-31)11-3-1-2-4-13-24(29)30/h5-6,8,12,18-20,23,27-28,31H,1-4,7,9-11,13-16H2,(H,29,30)/b26-22- |
| InChIKey | NTZSNDMQMUTGKH-ROMGYVFFSA-N |
| XLogP | 4.54 |
| TPSA | 110.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.55 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|