C24H36BrNO5 — CID 58654714
7-[(1R,2R,3Z,5S)-2-[(3S)-6-(3-bromophenyl)-3-hydroxyhexyl]-5-hydroxy-3-hydroxyiminocyclopentyl]heptanoic acid (PubChem CID 58654714) has the molecular formula C24H36BrNO5 and a molecular weight of 498.46 g/mol. Its IUPAC name is 7-[(1R,2R,3Z,5S)-2-[(3S)-6-(3-bromophenyl)-3-hydroxyhexyl]-5-hydroxy-3-hydroxyiminocyclopentyl]heptanoic acid.
| Compound Name | 7-[(1R,2R,3Z,5S)-2-[(3S)-6-(3-bromophenyl)-3-hydroxyhexyl]-5-hydroxy-3-hydroxyiminocyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 58654714 |
| Molecular Formula | C24H36BrNO5 |
| Molecular Weight | 498.46 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | 7-[(1R,2R,3Z,5S)-2-[(3S)-6-(3-bromophenyl)-3-hydroxyhexyl]-5-hydroxy-3-hydroxyiminocyclopentyl]heptanoic acid |
| SMILES | O=C(O)CCCCCC[C@H]1[C@@H](O)C/C(=N/O)[C@@H]1CC[C@@H](O)CCCc1cccc(Br)c1 |
| InChI | InChI=1S/C24H36BrNO5/c25-18-9-5-7-17(15-18)8-6-10-19(27)13-14-20-21(23(28)16-22(20)26-31)11-3-1-2-4-12-24(29)30/h5,7,9,15,19-21,23,27-28,31H,1-4,6,8,10-14,16H2,(H,29,30)/b26-22-/t19-,20+,21+,23-/m0/s1 |
| InChIKey | QZSBSXRHQSFRRE-JHWQEPTASA-N |
| XLogP | 5.17 |
| TPSA | 110.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.46 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|