C22H32FNO6 — CID 22970236
7-[(3Z)-2-[4-(4-fluorophenoxy)-3-hydroxybutyl]-5-hydroxy-3-hydroxyiminocyclopentyl]heptanoic acid (PubChem CID 22970236) has the molecular formula C22H32FNO6 and a molecular weight of 425.50 g/mol. Its IUPAC name is 7-[(3Z)-2-[4-(4-fluorophenoxy)-3-hydroxybutyl]-5-hydroxy-3-hydroxyiminocyclopentyl]heptanoic acid.
| Compound Name | 7-[(3Z)-2-[4-(4-fluorophenoxy)-3-hydroxybutyl]-5-hydroxy-3-hydroxyiminocyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 22970236 |
| Molecular Formula | C22H32FNO6 |
| Molecular Weight | 425.50 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | 7-[(3Z)-2-[4-(4-fluorophenoxy)-3-hydroxybutyl]-5-hydroxy-3-hydroxyiminocyclopentyl]heptanoic acid |
| SMILES | O=C(O)CCCCCCC1C(O)C/C(=N/O)C1CCC(O)COc1ccc(F)cc1 |
| InChI | InChI=1S/C22H32FNO6/c23-15-7-10-17(11-8-15)30-14-16(25)9-12-18-19(21(26)13-20(18)24-29)5-3-1-2-4-6-22(27)28/h7-8,10-11,16,18-19,21,25-26,29H,1-6,9,12-14H2,(H,27,28)/b24-20- |
| InChIKey | USJMVDUEZZCRTM-GFMRDNFCSA-N |
| XLogP | 3.60 |
| TPSA | 119.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.50 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|