C21H29FO6S — CID 22802463
7-[(1S,2R)-2-[3-(4-fluorophenoxy)-2-hydroxypropyl]sulfanyl-3-hydroxy-5-oxocyclopentyl]heptanoic acid (PubChem CID 22802463) has the molecular formula C21H29FO6S and a molecular weight of 428.52 g/mol. Its IUPAC name is 7-[(1S,2R)-2-[3-(4-fluorophenoxy)-2-hydroxypropyl]sulfanyl-3-hydroxy-5-oxocyclopentyl]heptanoic acid.
| Compound Name | 7-[(1S,2R)-2-[3-(4-fluorophenoxy)-2-hydroxypropyl]sulfanyl-3-hydroxy-5-oxocyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 22802463 |
| Molecular Formula | C21H29FO6S |
| Molecular Weight | 428.52 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | 7-[(1S,2R)-2-[3-(4-fluorophenoxy)-2-hydroxypropyl]sulfanyl-3-hydroxy-5-oxocyclopentyl]heptanoic acid |
| SMILES | O=C(O)CCCCCC[C@H]1C(=O)CC(O)[C@@H]1SCC(O)COc1ccc(F)cc1 |
| InChI | InChI=1S/C21H29FO6S/c22-14-7-9-16(10-8-14)28-12-15(23)13-29-21-17(18(24)11-19(21)25)5-3-1-2-4-6-20(26)27/h7-10,15,17,19,21,23,25H,1-6,11-13H2,(H,26,27)/t15?,17-,19?,21+/m0/s1 |
| InChIKey | WMKBIEPNADWANT-ZANJPXFNSA-N |
| XLogP | 3.04 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.52 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|