C20H27ClO5S — CID 22811387
7-[(1S,2R)-2-[2-(4-chlorophenyl)-2-hydroxyethyl]sulfanyl-3-hydroxy-5-oxocyclopentyl]heptanoic acid (PubChem CID 22811387) has the molecular formula C20H27ClO5S and a molecular weight of 414.95 g/mol. Its IUPAC name is 7-[(1S,2R)-2-[2-(4-chlorophenyl)-2-hydroxyethyl]sulfanyl-3-hydroxy-5-oxocyclopentyl]heptanoic acid.
| Compound Name | 7-[(1S,2R)-2-[2-(4-chlorophenyl)-2-hydroxyethyl]sulfanyl-3-hydroxy-5-oxocyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 22811387 |
| Molecular Formula | C20H27ClO5S |
| Molecular Weight | 414.95 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | 7-[(1S,2R)-2-[2-(4-chlorophenyl)-2-hydroxyethyl]sulfanyl-3-hydroxy-5-oxocyclopentyl]heptanoic acid |
| SMILES | O=C(O)CCCCCC[C@H]1C(=O)CC(O)[C@@H]1SCC(O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H27ClO5S/c21-14-9-7-13(8-10-14)18(24)12-27-20-15(16(22)11-17(20)23)5-3-1-2-4-6-19(25)26/h7-10,15,17-18,20,23-24H,1-6,11-12H2,(H,25,26)/t15-,17?,18?,20+/m0/s1 |
| InChIKey | OOXIPUGJAXOCBW-WVLNKYAVSA-N |
| XLogP | 3.85 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.95 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|