C26H34O5S — CID 54202271
methyl 7-[(1S,2R)-3-hydroxy-2-(2-hydroxypropylsulfanyl)-5-oxocyclopentyl]-2-naphthalen-2-ylheptanoate (PubChem CID 54202271) has the molecular formula C26H34O5S and a molecular weight of 458.62 g/mol. Its IUPAC name is methyl 7-[(1S,2R)-3-hydroxy-2-(2-hydroxypropylsulfanyl)-5-oxocyclopentyl]-2-naphthalen-2-ylheptanoate.
| Compound Name | methyl 7-[(1S,2R)-3-hydroxy-2-(2-hydroxypropylsulfanyl)-5-oxocyclopentyl]-2-naphthalen-2-ylheptanoate |
|---|---|
| PubChem CID | 54202271 |
| Molecular Formula | C26H34O5S |
| Molecular Weight | 458.62 g/mol |
| Exact Mass | 458.21 |
| IUPAC Name | methyl 7-[(1S,2R)-3-hydroxy-2-(2-hydroxypropylsulfanyl)-5-oxocyclopentyl]-2-naphthalen-2-ylheptanoate |
| SMILES | COC(=O)C(CCCCC[C@H]1C(=O)CC(O)[C@@H]1SCC(C)O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C26H34O5S/c1-17(27)16-32-25-22(23(28)15-24(25)29)11-5-3-4-10-21(26(30)31-2)20-13-12-18-8-6-7-9-19(18)14-20/h6-9,12-14,17,21-22,24-25,27,29H,3-5,10-11,15-16H2,1-2H3/t17?,21?,22-,24?,25+/m0/s1 |
| InChIKey | PQBYOONRXNDBKA-MLNVZZRCSA-N |
| XLogP | 4.48 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.62 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|