C24H42O5S — CID 57302282
methyl 2-hydroxy-3-(2-hydroxypropylsulfanyl)-7-[(1R,2R)-2-oct-1-enyl-5-oxocyclopentyl]heptanoate (PubChem CID 57302282) has the molecular formula C24H42O5S and a molecular weight of 442.66 g/mol. Its IUPAC name is methyl 2-hydroxy-3-(2-hydroxypropylsulfanyl)-7-[(1R,2R)-2-oct-1-enyl-5-oxocyclopentyl]heptanoate.
| Compound Name | methyl 2-hydroxy-3-(2-hydroxypropylsulfanyl)-7-[(1R,2R)-2-oct-1-enyl-5-oxocyclopentyl]heptanoate |
|---|---|
| PubChem CID | 57302282 |
| Molecular Formula | C24H42O5S |
| Molecular Weight | 442.66 g/mol |
| Exact Mass | 442.28 |
| IUPAC Name | methyl 2-hydroxy-3-(2-hydroxypropylsulfanyl)-7-[(1R,2R)-2-oct-1-enyl-5-oxocyclopentyl]heptanoate |
| SMILES | CCCCCCC=C[C@H]1CCC(=O)[C@@H]1CCCCC(SCC(C)O)C(O)C(=O)OC |
| InChI | InChI=1S/C24H42O5S/c1-4-5-6-7-8-9-12-19-15-16-21(26)20(19)13-10-11-14-22(30-17-18(2)25)23(27)24(28)29-3/h9,12,18-20,22-23,25,27H,4-8,10-11,13-17H2,1-3H3/t18?,19-,20+,22?,23?/m0/s1 |
| InChIKey | UXJYNINPBGBQGQ-SBZCJRAMSA-N |
| XLogP | 4.69 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.66 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|