C21H35FO5 — CID 57198673
2-fluoro-3-hydroxy-2-methoxy-7-[(1R,2R)-2-(4-methylhept-1-enyl)-5-oxocyclopentyl]heptanoic acid (PubChem CID 57198673) has the molecular formula C21H35FO5 and a molecular weight of 386.50 g/mol. Its IUPAC name is 2-fluoro-3-hydroxy-2-methoxy-7-[(1R,2R)-2-(4-methylhept-1-enyl)-5-oxocyclopentyl]heptanoic acid.
| Compound Name | 2-fluoro-3-hydroxy-2-methoxy-7-[(1R,2R)-2-(4-methylhept-1-enyl)-5-oxocyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 57198673 |
| Molecular Formula | C21H35FO5 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.25 |
| IUPAC Name | 2-fluoro-3-hydroxy-2-methoxy-7-[(1R,2R)-2-(4-methylhept-1-enyl)-5-oxocyclopentyl]heptanoic acid |
| SMILES | CCCC(C)CC=C[C@H]1CCC(=O)[C@@H]1CCCCC(O)C(F)(OC)C(=O)O |
| InChI | InChI=1S/C21H35FO5/c1-4-8-15(2)9-7-10-16-13-14-18(23)17(16)11-5-6-12-19(24)21(22,27-3)20(25)26/h7,10,15-17,19,24H,4-6,8-9,11-14H2,1-3H3,(H,25,26)/t15?,16-,17+,19?,21?/m0/s1 |
| InChIKey | SICVFCHWQBYUNA-ZGZAXYIHSA-N |
| XLogP | 4.28 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|