C22H38O4 — CID 56975673
trans-(2R,3R)-2-(7,8-dihydroxyoctyl)-3-(4-hydroxy-5-methylideneoct-1-enyl)cyclopentan-1-one (PubChem CID 56975673) has the molecular formula C22H38O4 and a molecular weight of 366.54 g/mol. Its IUPAC name is trans-(2R,3R)-2-(7,8-dihydroxyoctyl)-3-(4-hydroxy-5-methylideneoct-1-enyl)cyclopentan-1-one.
| Compound Name | trans-(2R,3R)-2-(7,8-dihydroxyoctyl)-3-(4-hydroxy-5-methylideneoct-1-enyl)cyclopentan-1-one |
|---|---|
| PubChem CID | 56975673 |
| Molecular Formula | C22H38O4 |
| Molecular Weight | 366.54 g/mol |
| Exact Mass | 366.28 |
| IUPAC Name | trans-(2R,3R)-2-(7,8-dihydroxyoctyl)-3-(4-hydroxy-5-methylideneoct-1-enyl)cyclopentan-1-one |
| SMILES | C=C(CCC)C(O)CC=C[C@H]1CCC(=O)[C@@H]1CCCCCCC(O)CO |
| InChI | InChI=1S/C22H38O4/c1-3-9-17(2)21(25)13-8-10-18-14-15-22(26)20(18)12-7-5-4-6-11-19(24)16-23/h8,10,18-21,23-25H,2-7,9,11-16H2,1H3/t18-,19?,20+,21?/m0/s1 |
| InChIKey | IYZADLZHKWHTFN-JJBAYQRUSA-N |
| XLogP | 3.94 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.54 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|