C21H34O5 — CID 70565599
7-[(1R,2R)-2-[(4R)-4-ethenylhept-1-enyl]-5-oxocyclopentyl]-2,2-dihydroxyheptanoic acid (PubChem CID 70565599) has the molecular formula C21H34O5 and a molecular weight of 366.50 g/mol. Its IUPAC name is 7-[(1R,2R)-2-[(4R)-4-ethenylhept-1-enyl]-5-oxocyclopentyl]-2,2-dihydroxyheptanoic acid.
| Compound Name | 7-[(1R,2R)-2-[(4R)-4-ethenylhept-1-enyl]-5-oxocyclopentyl]-2,2-dihydroxyheptanoic acid |
|---|---|
| PubChem CID | 70565599 |
| Molecular Formula | C21H34O5 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | 7-[(1R,2R)-2-[(4R)-4-ethenylhept-1-enyl]-5-oxocyclopentyl]-2,2-dihydroxyheptanoic acid |
| SMILES | C=C[C@@H](CC=C[C@H]1CCC(=O)[C@@H]1CCCCCC(O)(O)C(=O)O)CCC |
| InChI | InChI=1S/C21H34O5/c1-3-9-16(4-2)10-8-11-17-13-14-19(22)18(17)12-6-5-7-15-21(25,26)20(23)24/h4,8,11,16-18,25-26H,2-3,5-7,9-10,12-15H2,1H3,(H,23,24)/t16-,17+,18-/m1/s1 |
| InChIKey | IKTXKHAJFXZIHB-FGTMMUONSA-N |
| XLogP | 3.85 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|