C25H44O5 — CID 57055130
7-[(1R,2R)-2-(4,4-dimethyloct-1-enyl)-5-oxocyclopentyl]-2-hydroxy-2-propoxyheptanoic acid (PubChem CID 57055130) has the molecular formula C25H44O5 and a molecular weight of 424.62 g/mol. Its IUPAC name is 7-[(1R,2R)-2-(4,4-dimethyloct-1-enyl)-5-oxocyclopentyl]-2-hydroxy-2-propoxyheptanoic acid.
| Compound Name | 7-[(1R,2R)-2-(4,4-dimethyloct-1-enyl)-5-oxocyclopentyl]-2-hydroxy-2-propoxyheptanoic acid |
|---|---|
| PubChem CID | 57055130 |
| Molecular Formula | C25H44O5 |
| Molecular Weight | 424.62 g/mol |
| Exact Mass | 424.32 |
| IUPAC Name | 7-[(1R,2R)-2-(4,4-dimethyloct-1-enyl)-5-oxocyclopentyl]-2-hydroxy-2-propoxyheptanoic acid |
| SMILES | CCCCC(C)(C)CC=C[C@H]1CCC(=O)[C@@H]1CCCCCC(O)(OCCC)C(=O)O |
| InChI | InChI=1S/C25H44O5/c1-5-7-16-24(3,4)17-11-12-20-14-15-22(26)21(20)13-9-8-10-18-25(29,23(27)28)30-19-6-2/h11-12,20-21,29H,5-10,13-19H2,1-4H3,(H,27,28)/t20-,21+,25?/m0/s1 |
| InChIKey | CFOUWXXTCGNVBC-SXNCYPNXSA-N |
| XLogP | 5.89 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.62 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|