C23H42O5 — CID 54571925
7-[(1R,2S)-2-(5,5-dimethyloctyl)-5-oxocyclopentyl]-2-hydroxy-2-methoxyheptanoic acid (PubChem CID 54571925) has the molecular formula C23H42O5 and a molecular weight of 398.58 g/mol. Its IUPAC name is 7-[(1R,2S)-2-(5,5-dimethyloctyl)-5-oxocyclopentyl]-2-hydroxy-2-methoxyheptanoic acid.
| Compound Name | 7-[(1R,2S)-2-(5,5-dimethyloctyl)-5-oxocyclopentyl]-2-hydroxy-2-methoxyheptanoic acid |
|---|---|
| PubChem CID | 54571925 |
| Molecular Formula | C23H42O5 |
| Molecular Weight | 398.58 g/mol |
| Exact Mass | 398.30 |
| IUPAC Name | 7-[(1R,2S)-2-(5,5-dimethyloctyl)-5-oxocyclopentyl]-2-hydroxy-2-methoxyheptanoic acid |
| SMILES | CCCC(C)(C)CCCC[C@H]1CCC(=O)[C@@H]1CCCCCC(O)(OC)C(=O)O |
| InChI | InChI=1S/C23H42O5/c1-5-15-22(2,3)16-10-8-11-18-13-14-20(24)19(18)12-7-6-9-17-23(27,28-4)21(25)26/h18-19,27H,5-17H2,1-4H3,(H,25,26)/t18-,19+,23?/m0/s1 |
| InChIKey | ZXXHGXXWQQWDFM-HXIJRHRVSA-N |
| XLogP | 5.34 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.58 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|