C20H33F2O4 — CID 58749586
CID 58749586 (PubChem CID 58749586) has the molecular formula C20H33F2O4 and a molecular weight of 375.48 g/mol.
| Compound Name | CID 58749586 |
|---|---|
| PubChem CID | 58749586 |
| Molecular Formula | C20H33F2O4 |
| Molecular Weight | 375.48 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | — |
| SMILES | CCCCC(F)(F)[C](O)CC[C@H]1CCC(=O)[C@@H]1CCCCCCC(=O)O |
| InChI | InChI=1S/C20H33F2O4/c1-2-3-14-20(21,22)18(24)13-11-15-10-12-17(23)16(15)8-6-4-5-7-9-19(25)26/h15-16,24H,2-14H2,1H3,(H,25,26)/t15-,16-/m1/s1 |
| InChIKey | HXVMOMRXQYFVAL-HZPDHXFCSA-N |
| XLogP | 5.52 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.48 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|