C22H36F2O4 — CID 11996442
7-[(1R,2R)-2-(4,4-difluoro-3-oxodecyl)-5-oxocyclopentyl]heptanoic acid (PubChem CID 11996442) has the molecular formula C22H36F2O4 and a molecular weight of 402.52 g/mol. Its IUPAC name is 7-[(1R,2R)-2-(4,4-difluoro-3-oxodecyl)-5-oxocyclopentyl]heptanoic acid.
| Compound Name | 7-[(1R,2R)-2-(4,4-difluoro-3-oxodecyl)-5-oxocyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 11996442 |
| Molecular Formula | C22H36F2O4 |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.26 |
| IUPAC Name | 7-[(1R,2R)-2-(4,4-difluoro-3-oxodecyl)-5-oxocyclopentyl]heptanoic acid |
| SMILES | CCCCCCC(F)(F)C(=O)CC[C@H]1CCC(=O)[C@@H]1CCCCCCC(=O)O |
| InChI | InChI=1S/C22H36F2O4/c1-2-3-4-9-16-22(23,24)20(26)15-13-17-12-14-19(25)18(17)10-7-5-6-8-11-21(27)28/h17-18H,2-16H2,1H3,(H,27,28)/t17-,18-/m1/s1 |
| InChIKey | WYHKJCARZHTMRW-QZTJIDSGSA-N |
| XLogP | 5.96 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|