C24H44O3 — CID 22797043
butyl 7-[(1R,2S)-2-octyl-5-oxocyclopentyl]heptanoate (PubChem CID 22797043) has the molecular formula C24H44O3 and a molecular weight of 380.61 g/mol. Its IUPAC name is butyl 7-[(1R,2S)-2-octyl-5-oxocyclopentyl]heptanoate.
| Compound Name | butyl 7-[(1R,2S)-2-octyl-5-oxocyclopentyl]heptanoate |
|---|---|
| PubChem CID | 22797043 |
| Molecular Formula | C24H44O3 |
| Molecular Weight | 380.61 g/mol |
| Exact Mass | 380.33 |
| IUPAC Name | butyl 7-[(1R,2S)-2-octyl-5-oxocyclopentyl]heptanoate |
| SMILES | CCCCCCCC[C@H]1CCC(=O)[C@@H]1CCCCCCC(=O)OCCCC |
| InChI | InChI=1S/C24H44O3/c1-3-5-7-8-9-12-15-21-18-19-23(25)22(21)16-13-10-11-14-17-24(26)27-20-6-4-2/h21-22H,3-20H2,1-2H3/t21-,22+/m0/s1 |
| InChIKey | PFKVRXRLTKFENJ-FCHUYYIVSA-N |
| XLogP | 7.02 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.61 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|