C28H52O4 — CID 18594645
butyl 7-[(1R,2S)-2-[3-[(2-methylpropan-2-yl)oxy]octyl]-5-oxocyclopentyl]heptanoate (PubChem CID 18594645) has the molecular formula C28H52O4 and a molecular weight of 452.72 g/mol. Its IUPAC name is butyl 7-[(1R,2S)-2-[3-[(2-methylpropan-2-yl)oxy]octyl]-5-oxocyclopentyl]heptanoate.
| Compound Name | butyl 7-[(1R,2S)-2-[3-[(2-methylpropan-2-yl)oxy]octyl]-5-oxocyclopentyl]heptanoate |
|---|---|
| PubChem CID | 18594645 |
| Molecular Formula | C28H52O4 |
| Molecular Weight | 452.72 g/mol |
| Exact Mass | 452.39 |
| IUPAC Name | butyl 7-[(1R,2S)-2-[3-[(2-methylpropan-2-yl)oxy]octyl]-5-oxocyclopentyl]heptanoate |
| SMILES | CCCCCC(CC[C@H]1CCC(=O)[C@@H]1CCCCCCC(=O)OCCCC)OC(C)(C)C |
| InChI | InChI=1S/C28H52O4/c1-6-8-12-15-24(32-28(3,4)5)20-18-23-19-21-26(29)25(23)16-13-10-11-14-17-27(30)31-22-9-7-2/h23-25H,6-22H2,1-5H3/t23-,24?,25+/m0/s1 |
| InChIKey | JZNCHTQAPSTLFR-QNRWSGHRSA-N |
| XLogP | 7.81 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.72 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|