C21H38O3 — CID 22797039
propan-2-yl 7-[(1R,2S)-2-hexyl-5-oxocyclopentyl]heptanoate (PubChem CID 22797039) has the molecular formula C21H38O3 and a molecular weight of 338.53 g/mol. Its IUPAC name is propan-2-yl 7-[(1R,2S)-2-hexyl-5-oxocyclopentyl]heptanoate.
| Compound Name | propan-2-yl 7-[(1R,2S)-2-hexyl-5-oxocyclopentyl]heptanoate |
|---|---|
| PubChem CID | 22797039 |
| Molecular Formula | C21H38O3 |
| Molecular Weight | 338.53 g/mol |
| Exact Mass | 338.28 |
| IUPAC Name | propan-2-yl 7-[(1R,2S)-2-hexyl-5-oxocyclopentyl]heptanoate |
| SMILES | CCCCCC[C@H]1CCC(=O)[C@@H]1CCCCCCC(=O)OC(C)C |
| InChI | InChI=1S/C21H38O3/c1-4-5-6-9-12-18-15-16-20(22)19(18)13-10-7-8-11-14-21(23)24-17(2)3/h17-19H,4-16H2,1-3H3/t18-,19+/m0/s1 |
| InChIKey | IZWVVJZUAXLAPM-RBUKOAKNSA-N |
| XLogP | 5.84 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.53 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|