C22H38O4 — CID 54107228
ethyl 7-[(1R,2S)-2-octyl-5-oxocyclopentyl]-2-oxoheptanoate (PubChem CID 54107228) has the molecular formula C22H38O4 and a molecular weight of 366.54 g/mol. Its IUPAC name is ethyl 7-[(1R,2S)-2-octyl-5-oxocyclopentyl]-2-oxoheptanoate.
| Compound Name | ethyl 7-[(1R,2S)-2-octyl-5-oxocyclopentyl]-2-oxoheptanoate |
|---|---|
| PubChem CID | 54107228 |
| Molecular Formula | C22H38O4 |
| Molecular Weight | 366.54 g/mol |
| Exact Mass | 366.28 |
| IUPAC Name | ethyl 7-[(1R,2S)-2-octyl-5-oxocyclopentyl]-2-oxoheptanoate |
| SMILES | CCCCCCCC[C@H]1CCC(=O)[C@@H]1CCCCCC(=O)C(=O)OCC |
| InChI | InChI=1S/C22H38O4/c1-3-5-6-7-8-10-13-18-16-17-20(23)19(18)14-11-9-12-15-21(24)22(25)26-4-2/h18-19H,3-17H2,1-2H3/t18-,19+/m0/s1 |
| InChIKey | NEPFFVMPYJZSRK-RBUKOAKNSA-N |
| XLogP | 5.41 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.54 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|