C22H39FO4 — CID 54244961
ethyl 2-fluoro-7-[(1R,2S)-2-(4-hydroxyoctyl)-5-oxocyclopentyl]heptanoate (PubChem CID 54244961) has the molecular formula C22H39FO4 and a molecular weight of 386.55 g/mol. Its IUPAC name is ethyl 2-fluoro-7-[(1R,2S)-2-(4-hydroxyoctyl)-5-oxocyclopentyl]heptanoate.
| Compound Name | ethyl 2-fluoro-7-[(1R,2S)-2-(4-hydroxyoctyl)-5-oxocyclopentyl]heptanoate |
|---|---|
| PubChem CID | 54244961 |
| Molecular Formula | C22H39FO4 |
| Molecular Weight | 386.55 g/mol |
| Exact Mass | 386.28 |
| IUPAC Name | ethyl 2-fluoro-7-[(1R,2S)-2-(4-hydroxyoctyl)-5-oxocyclopentyl]heptanoate |
| SMILES | CCCCC(O)CCC[C@H]1CCC(=O)[C@@H]1CCCCCC(F)C(=O)OCC |
| InChI | InChI=1S/C22H39FO4/c1-3-5-11-18(24)12-9-10-17-15-16-21(25)19(17)13-7-6-8-14-20(23)22(26)27-4-2/h17-20,24H,3-16H2,1-2H3/t17-,18?,19+,20?/m0/s1 |
| InChIKey | QSPIDUPNBIHMDI-LHQJTOJGSA-N |
| XLogP | 5.15 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.55 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|