C26H48O4 — CID 86732938
ethyl 7-[(1R,2S)-2-[3-[(2-methylpropan-2-yl)oxy]octyl]-5-oxocyclopentyl]heptanoate (PubChem CID 86732938) has the molecular formula C26H48O4 and a molecular weight of 424.67 g/mol. Its IUPAC name is ethyl 7-[(1R,2S)-2-[3-[(2-methylpropan-2-yl)oxy]octyl]-5-oxocyclopentyl]heptanoate.
| Compound Name | ethyl 7-[(1R,2S)-2-[3-[(2-methylpropan-2-yl)oxy]octyl]-5-oxocyclopentyl]heptanoate |
|---|---|
| PubChem CID | 86732938 |
| Molecular Formula | C26H48O4 |
| Molecular Weight | 424.67 g/mol |
| Exact Mass | 424.36 |
| IUPAC Name | ethyl 7-[(1R,2S)-2-[3-[(2-methylpropan-2-yl)oxy]octyl]-5-oxocyclopentyl]heptanoate |
| SMILES | CCCCCC(CC[C@H]1CCC(=O)[C@@H]1CCCCCCC(=O)OCC)OC(C)(C)C |
| InChI | InChI=1S/C26H48O4/c1-6-8-11-14-22(30-26(3,4)5)19-17-21-18-20-24(27)23(21)15-12-9-10-13-16-25(28)29-7-2/h21-23H,6-20H2,1-5H3/t21-,22?,23+/m0/s1 |
| InChIKey | PDGZARDFTGOJLQ-OCESARCHSA-N |
| XLogP | 7.03 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.67 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|