C17H30O3 — CID 22797030
ethyl 7-[(1R,5R)-2-oxo-5-propan-2-ylcyclopentyl]heptanoate (PubChem CID 22797030) has the molecular formula C17H30O3 and a molecular weight of 282.42 g/mol. Its IUPAC name is ethyl 7-[(1R,5R)-2-oxo-5-propan-2-ylcyclopentyl]heptanoate.
| Compound Name | ethyl 7-[(1R,5R)-2-oxo-5-propan-2-ylcyclopentyl]heptanoate |
|---|---|
| PubChem CID | 22797030 |
| Molecular Formula | C17H30O3 |
| Molecular Weight | 282.42 g/mol |
| Exact Mass | 282.22 |
| IUPAC Name | ethyl 7-[(1R,5R)-2-oxo-5-propan-2-ylcyclopentyl]heptanoate |
| SMILES | CCOC(=O)CCCCCC[C@H]1C(=O)CC[C@@H]1C(C)C |
| InChI | InChI=1S/C17H30O3/c1-4-20-17(19)10-8-6-5-7-9-15-14(13(2)3)11-12-16(15)18/h13-15H,4-12H2,1-3H3/t14-,15-/m1/s1 |
| InChIKey | RKOCAYBZPJQKIO-HUUCEWRRSA-N |
| XLogP | 4.14 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.42 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|