C24H43FO4 — CID 22796890
butyl 7-[(1R,2S)-2-[(3S)-4-fluoro-3-hydroxyoctyl]-5-oxocyclopentyl]heptanoate (PubChem CID 22796890) has the molecular formula C24H43FO4 and a molecular weight of 414.60 g/mol. Its IUPAC name is butyl 7-[(1R,2S)-2-[(3S)-4-fluoro-3-hydroxyoctyl]-5-oxocyclopentyl]heptanoate.
| Compound Name | butyl 7-[(1R,2S)-2-[(3S)-4-fluoro-3-hydroxyoctyl]-5-oxocyclopentyl]heptanoate |
|---|---|
| PubChem CID | 22796890 |
| Molecular Formula | C24H43FO4 |
| Molecular Weight | 414.60 g/mol |
| Exact Mass | 414.31 |
| IUPAC Name | butyl 7-[(1R,2S)-2-[(3S)-4-fluoro-3-hydroxyoctyl]-5-oxocyclopentyl]heptanoate |
| SMILES | CCCCOC(=O)CCCCCC[C@H]1C(=O)CC[C@@H]1CC[C@H](O)C(F)CCCC |
| InChI | InChI=1S/C24H43FO4/c1-3-5-12-21(25)23(27)17-15-19-14-16-22(26)20(19)11-9-7-8-10-13-24(28)29-18-6-4-2/h19-21,23,27H,3-18H2,1-2H3/t19-,20-,21?,23+/m1/s1 |
| InChIKey | SZAHYIFAFCVLLF-WOZJNHHRSA-N |
| XLogP | 5.93 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.60 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|