C25H44O4 — CID 54460201
ethyl 7-[(1R,2S)-2-(5,5-dimethyloctyl)-5-oxocyclopentyl]-2-methyl-3-oxoheptanoate (PubChem CID 54460201) has the molecular formula C25H44O4 and a molecular weight of 408.62 g/mol. Its IUPAC name is ethyl 7-[(1R,2S)-2-(5,5-dimethyloctyl)-5-oxocyclopentyl]-2-methyl-3-oxoheptanoate.
| Compound Name | ethyl 7-[(1R,2S)-2-(5,5-dimethyloctyl)-5-oxocyclopentyl]-2-methyl-3-oxoheptanoate |
|---|---|
| PubChem CID | 54460201 |
| Molecular Formula | C25H44O4 |
| Molecular Weight | 408.62 g/mol |
| Exact Mass | 408.32 |
| IUPAC Name | ethyl 7-[(1R,2S)-2-(5,5-dimethyloctyl)-5-oxocyclopentyl]-2-methyl-3-oxoheptanoate |
| SMILES | CCCC(C)(C)CCCC[C@H]1CCC(=O)[C@@H]1CCCCC(=O)C(C)C(=O)OCC |
| InChI | InChI=1S/C25H44O4/c1-6-17-25(4,5)18-11-10-12-20-15-16-23(27)21(20)13-8-9-14-22(26)19(3)24(28)29-7-2/h19-21H,6-18H2,1-5H3/t19?,20-,21+/m0/s1 |
| InChIKey | XBCHGKAYZGLYQO-GJGLBJJNSA-N |
| XLogP | 6.30 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.62 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|