C22H40O5 — CID 54023628
trans-(2R,3S)-3-[4-hydroxy-4-(hydroxymethyl)octyl]-2-(8-hydroxy-7-oxooctyl)cyclopentan-1-one (PubChem CID 54023628) has the molecular formula C22H40O5 and a molecular weight of 384.56 g/mol. Its IUPAC name is trans-(2R,3S)-3-[4-hydroxy-4-(hydroxymethyl)octyl]-2-(8-hydroxy-7-oxooctyl)cyclopentan-1-one.
| Compound Name | trans-(2R,3S)-3-[4-hydroxy-4-(hydroxymethyl)octyl]-2-(8-hydroxy-7-oxooctyl)cyclopentan-1-one |
|---|---|
| PubChem CID | 54023628 |
| Molecular Formula | C22H40O5 |
| Molecular Weight | 384.56 g/mol |
| Exact Mass | 384.29 |
| IUPAC Name | trans-(2R,3S)-3-[4-hydroxy-4-(hydroxymethyl)octyl]-2-(8-hydroxy-7-oxooctyl)cyclopentan-1-one |
| SMILES | CCCCC(O)(CO)CCC[C@H]1CCC(=O)[C@@H]1CCCCCCC(=O)CO |
| InChI | InChI=1S/C22H40O5/c1-2-3-14-22(27,17-24)15-8-9-18-12-13-21(26)20(18)11-7-5-4-6-10-19(25)16-23/h18,20,23-24,27H,2-17H2,1H3/t18-,20+,22?/m0/s1 |
| InChIKey | LAQCZFIDBCSNFD-RUYIAYPLSA-N |
| XLogP | 3.57 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.56 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|