C24H40O4 — CID 57201880
trans-(2R,3R)-3-(4-cyclopropyl-4-hydroxyoct-1-enyl)-2-(8-hydroxy-7-oxooctyl)cyclopentan-1-one (PubChem CID 57201880) has the molecular formula C24H40O4 and a molecular weight of 392.58 g/mol. Its IUPAC name is trans-(2R,3R)-3-(4-cyclopropyl-4-hydroxyoct-1-enyl)-2-(8-hydroxy-7-oxooctyl)cyclopentan-1-one.
| Compound Name | trans-(2R,3R)-3-(4-cyclopropyl-4-hydroxyoct-1-enyl)-2-(8-hydroxy-7-oxooctyl)cyclopentan-1-one |
|---|---|
| PubChem CID | 57201880 |
| Molecular Formula | C24H40O4 |
| Molecular Weight | 392.58 g/mol |
| Exact Mass | 392.29 |
| IUPAC Name | trans-(2R,3R)-3-(4-cyclopropyl-4-hydroxyoct-1-enyl)-2-(8-hydroxy-7-oxooctyl)cyclopentan-1-one |
| SMILES | CCCCC(O)(CC=C[C@H]1CCC(=O)[C@@H]1CCCCCCC(=O)CO)C1CC1 |
| InChI | InChI=1S/C24H40O4/c1-2-3-16-24(28,20-13-14-20)17-8-9-19-12-15-23(27)22(19)11-7-5-4-6-10-21(26)18-25/h8-9,19-20,22,25,28H,2-7,10-18H2,1H3/t19-,22+,24?/m0/s1 |
| InChIKey | KFUJKAASWJFTTF-VBLFYTBKSA-N |
| XLogP | 4.76 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.58 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|