C24H44O6 — CID 57242935
2-hydroxy-2-(2-hydroxyethoxy)-3,3-dimethyl-7-[(1R,2S)-2-octyl-5-oxocyclopentyl]heptanoic acid (PubChem CID 57242935) has the molecular formula C24H44O6 and a molecular weight of 428.61 g/mol. Its IUPAC name is 2-hydroxy-2-(2-hydroxyethoxy)-3,3-dimethyl-7-[(1R,2S)-2-octyl-5-oxocyclopentyl]heptanoic acid.
| Compound Name | 2-hydroxy-2-(2-hydroxyethoxy)-3,3-dimethyl-7-[(1R,2S)-2-octyl-5-oxocyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 57242935 |
| Molecular Formula | C24H44O6 |
| Molecular Weight | 428.61 g/mol |
| Exact Mass | 428.31 |
| IUPAC Name | 2-hydroxy-2-(2-hydroxyethoxy)-3,3-dimethyl-7-[(1R,2S)-2-octyl-5-oxocyclopentyl]heptanoic acid |
| SMILES | CCCCCCCC[C@H]1CCC(=O)[C@@H]1CCCCC(C)(C)C(O)(OCCO)C(=O)O |
| InChI | InChI=1S/C24H44O6/c1-4-5-6-7-8-9-12-19-14-15-21(26)20(19)13-10-11-16-23(2,3)24(29,22(27)28)30-18-17-25/h19-20,25,29H,4-18H2,1-3H3,(H,27,28)/t19-,20+,24?/m0/s1 |
| InChIKey | OXZSZFCYRAEADJ-ZPVKFHTISA-N |
| XLogP | 4.70 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.61 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|