C28H44O6 — CID 57318162
3-hydroxy-2-(2-hydroxyethoxy)-7-[(1R,2S)-2-octyl-5-oxocyclopentyl]-2-phenylheptanoic acid (PubChem CID 57318162) has the molecular formula C28H44O6 and a molecular weight of 476.65 g/mol. Its IUPAC name is 3-hydroxy-2-(2-hydroxyethoxy)-7-[(1R,2S)-2-octyl-5-oxocyclopentyl]-2-phenylheptanoic acid.
| Compound Name | 3-hydroxy-2-(2-hydroxyethoxy)-7-[(1R,2S)-2-octyl-5-oxocyclopentyl]-2-phenylheptanoic acid |
|---|---|
| PubChem CID | 57318162 |
| Molecular Formula | C28H44O6 |
| Molecular Weight | 476.65 g/mol |
| Exact Mass | 476.31 |
| IUPAC Name | 3-hydroxy-2-(2-hydroxyethoxy)-7-[(1R,2S)-2-octyl-5-oxocyclopentyl]-2-phenylheptanoic acid |
| SMILES | CCCCCCCC[C@H]1CCC(=O)[C@@H]1CCCCC(O)C(OCCO)(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C28H44O6/c1-2-3-4-5-6-8-13-22-18-19-25(30)24(22)16-11-12-17-26(31)28(27(32)33,34-21-20-29)23-14-9-7-10-15-23/h7,9-10,14-15,22,24,26,29,31H,2-6,8,11-13,16-21H2,1H3,(H,32,33)/t22-,24+,26?,28?/m0/s1 |
| InChIKey | DNFSCJFHPNXUNF-QACPUVQFSA-N |
| XLogP | 5.24 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.65 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|