C20H36O4S — CID 163826254
2-[4-[(1R,2S)-2-[3-(hydroxymethyl)octyl]-5-oxocyclopentyl]butylsulfanyl]acetic acid (PubChem CID 163826254) has the molecular formula C20H36O4S and a molecular weight of 372.57 g/mol. Its IUPAC name is 2-[4-[(1R,2S)-2-[3-(hydroxymethyl)octyl]-5-oxocyclopentyl]butylsulfanyl]acetic acid.
| Compound Name | 2-[4-[(1R,2S)-2-[3-(hydroxymethyl)octyl]-5-oxocyclopentyl]butylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 163826254 |
| Molecular Formula | C20H36O4S |
| Molecular Weight | 372.57 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | 2-[4-[(1R,2S)-2-[3-(hydroxymethyl)octyl]-5-oxocyclopentyl]butylsulfanyl]acetic acid |
| SMILES | CCCCCC(CO)CC[C@H]1CCC(=O)[C@@H]1CCCCSCC(=O)O |
| InChI | InChI=1S/C20H36O4S/c1-2-3-4-7-16(14-21)9-10-17-11-12-19(22)18(17)8-5-6-13-25-15-20(23)24/h16-18,21H,2-15H2,1H3,(H,23,24)/t16?,17-,18+/m0/s1 |
| InChIKey | NZSYKRXSSDTXIH-UQJFVLDMSA-N |
| XLogP | 4.54 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.57 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|