C15H28O5 — CID 154944035
ethane-1,2-diol;methyl 2-[(1S,2S)-3-oxo-2-pentylcyclopentyl]acetate (PubChem CID 154944035) has the molecular formula C15H28O5 and a molecular weight of 288.38 g/mol. Its IUPAC name is ethane-1,2-diol;methyl 2-[(1S,2S)-3-oxo-2-pentylcyclopentyl]acetate.
| Compound Name | ethane-1,2-diol;methyl 2-[(1S,2S)-3-oxo-2-pentylcyclopentyl]acetate |
|---|---|
| PubChem CID | 154944035 |
| Molecular Formula | C15H28O5 |
| Molecular Weight | 288.38 g/mol |
| Exact Mass | 288.19 |
| IUPAC Name | ethane-1,2-diol;methyl 2-[(1S,2S)-3-oxo-2-pentylcyclopentyl]acetate |
| SMILES | CCCCC[C@@H]1C(=O)CC[C@H]1CC(=O)OC.OCCO |
| InChI | InChI=1S/C13H22O3.C2H6O2/c1-3-4-5-6-11-10(7-8-12(11)14)9-13(15)16-2;3-1-2-4/h10-11H,3-9H2,1-2H3;3-4H,1-2H2/t10-,11-;/m0./s1 |
| InChIKey | BWTMPIWKIVSLDX-ACMTZBLWSA-N |
| XLogP | 1.70 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.38 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|