C15H25NO4 — CID 124867076
methyl 2-[(1S,2S)-3-acetyloxyimino-2-pentylcyclopentyl]acetate (PubChem CID 124867076) has the molecular formula C15H25NO4 and a molecular weight of 283.37 g/mol. Its IUPAC name is methyl 2-[(1S,2S)-3-acetyloxyimino-2-pentylcyclopentyl]acetate.
| Compound Name | methyl 2-[(1S,2S)-3-acetyloxyimino-2-pentylcyclopentyl]acetate |
|---|---|
| PubChem CID | 124867076 |
| Molecular Formula | C15H25NO4 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | methyl 2-[(1S,2S)-3-acetyloxyimino-2-pentylcyclopentyl]acetate |
| SMILES | CCCCC[C@@H]1C(=NOC(C)=O)CC[C@H]1CC(=O)OC |
| InChI | InChI=1S/C15H25NO4/c1-4-5-6-7-13-12(10-15(18)19-3)8-9-14(13)16-20-11(2)17/h12-13H,4-10H2,1-3H3/t12-,13-/m0/s1 |
| InChIKey | UOKKDVAEKABFRY-STQMWFEESA-N |
| XLogP | 3.08 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|