About methyl 2-[(1R,2R,3E)-3-acetyloxyimino-2-pentylcyclopentyl]acetate
methyl 2-[(1R,2R,3E)-3-acetyloxyimino-2-pentylcyclopentyl]acetate (PubChem CID 7074886) has the molecular formula C15H25NO4
and a molecular weight of 283.37 g/mol. Its IUPAC name is methyl 2-[(1R,2R,3E)-3-acetyloxyimino-2-pentylcyclopentyl]acetate.
Molecular Properties
| Compound Name | methyl 2-[(1R,2R,3E)-3-acetyloxyimino-2-pentylcyclopentyl]acetate |
| PubChem CID | 7074886 |
| Molecular Formula | C15H25NO4 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | methyl 2-[(1R,2R,3E)-3-acetyloxyimino-2-pentylcyclopentyl]acetate |
| SMILES | CCCCC[C@H]1/C(=N/OC(C)=O)CC[C@@H]1CC(=O)OC |
| InChI | InChI=1S/C15H25NO4/c1-4-5-6-7-13-12(10-15(18)19-3)8-9-14(13)16-20-11(2)17/h12-13H,4-10H2,1-3H3/b16-14+/t12-,13-/m1/s1 |
| InChIKey | UOKKDVAEKABFRY-NDCYMYPRSA-N |
| XLogP | 3.08 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[(1R,2R,3E)-3-acetyloxyimino-2-pentylcyclopentyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(1R,2R,3E)-3-acetyloxyimino-2-pentylcyclopentyl]acetate?
The IUPAC name of methyl 2-[(1R,2R,3E)-3-acetyloxyimino-2-pentylcyclopentyl]acetate (CID 7074886) is methyl 2-[(1R,2R,3E)-3-acetyloxyimino-2-pentylcyclopentyl]acetate.
What is the SMILES notation for methyl 2-[(1R,2R,3E)-3-acetyloxyimino-2-pentylcyclopentyl]acetate?
The canonical SMILES for methyl 2-[(1R,2R,3E)-3-acetyloxyimino-2-pentylcyclopentyl]acetate is CCCCC[C@H]1/C(=N/OC(C)=O)CC[C@@H]1CC(=O)OC.
What is the InChIKey of methyl 2-[(1R,2R,3E)-3-acetyloxyimino-2-pentylcyclopentyl]acetate?
The InChIKey is UOKKDVAEKABFRY-NDCYMYPRSA-N. The full InChI is InChI=1S/C15H25NO4/c1-4-5-6-7-13-12(10-15(18)19-3)8-9-14(13)16-20-11(2)17/h12-13H,4-10H2,1-3H3/b16-14+/t12-,13-/m1/s1.
What are the key properties of methyl 2-[(1R,2R,3E)-3-acetyloxyimino-2-pentylcyclopentyl]acetate?
methyl 2-[(1R,2R,3E)-3-acetyloxyimino-2-pentylcyclopentyl]acetate has a molecular weight of 283.37 g/mol, XLogP of 3.08, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(1R,2R,3E)-3-acetyloxyimino-2-pentylcyclopentyl]acetate is sourced from PubChem (CID 7074886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).