C24H42O6 — CID 157449570
2-[(1R,2R)-3-hydroxy-2-pentylcyclopentyl]acetic acid;2-[(1R,2R)-3-oxo-2-pentylcyclopentyl]acetic acid (PubChem CID 157449570) has the molecular formula C24H42O6 and a molecular weight of 426.59 g/mol. Its IUPAC name is 2-[(1R,2R)-3-hydroxy-2-pentylcyclopentyl]acetic acid;2-[(1R,2R)-3-oxo-2-pentylcyclopentyl]acetic acid.
| Compound Name | 2-[(1R,2R)-3-hydroxy-2-pentylcyclopentyl]acetic acid;2-[(1R,2R)-3-oxo-2-pentylcyclopentyl]acetic acid |
|---|---|
| PubChem CID | 157449570 |
| Molecular Formula | C24H42O6 |
| Molecular Weight | 426.59 g/mol |
| Exact Mass | 426.30 |
| IUPAC Name | 2-[(1R,2R)-3-hydroxy-2-pentylcyclopentyl]acetic acid;2-[(1R,2R)-3-oxo-2-pentylcyclopentyl]acetic acid |
| SMILES | CCCCC[C@H]1C(=O)CC[C@@H]1CC(=O)O.CCCCC[C@H]1C(O)CC[C@@H]1CC(=O)O |
| InChI | InChI=1S/C12H22O3.C12H20O3/c2*1-2-3-4-5-10-9(8-12(14)15)6-7-11(10)13/h9-11,13H,2-8H2,1H3,(H,14,15);9-10H,2-8H2,1H3,(H,14,15)/t9-,10-,11?;9-,10-/m11/s1 |
| InChIKey | BSQHPTJJGTVXDH-GTLDFVCKSA-N |
| XLogP | 5.07 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.59 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|