C19H32O4S — CID 54498004
2-hydroxy-2-[4-[(1R,2S)-2-oct-4-enyl-5-oxocyclopentyl]butylsulfanyl]acetic acid (PubChem CID 54498004) has the molecular formula C19H32O4S and a molecular weight of 356.53 g/mol. Its IUPAC name is 2-hydroxy-2-[4-[(1R,2S)-2-oct-4-enyl-5-oxocyclopentyl]butylsulfanyl]acetic acid.
| Compound Name | 2-hydroxy-2-[4-[(1R,2S)-2-oct-4-enyl-5-oxocyclopentyl]butylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 54498004 |
| Molecular Formula | C19H32O4S |
| Molecular Weight | 356.53 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | 2-hydroxy-2-[4-[(1R,2S)-2-oct-4-enyl-5-oxocyclopentyl]butylsulfanyl]acetic acid |
| SMILES | CCCC=CCCC[C@H]1CCC(=O)[C@@H]1CCCCSC(O)C(=O)O |
| InChI | InChI=1S/C19H32O4S/c1-2-3-4-5-6-7-10-15-12-13-17(20)16(15)11-8-9-14-24-19(23)18(21)22/h4-5,15-16,19,23H,2-3,6-14H2,1H3,(H,21,22)/t15-,16+,19?/m0/s1 |
| InChIKey | YAMCFADXOQDZML-GWFKTICUSA-N |
| XLogP | 4.41 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.53 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|