C16H26O — CID 57173392
trans-(2R,3S)-2-hexa-3,5-dienyl-3-pentylcyclopentan-1-one (PubChem CID 57173392) has the molecular formula C16H26O and a molecular weight of 234.38 g/mol. Its IUPAC name is trans-(2R,3S)-2-hexa-3,5-dienyl-3-pentylcyclopentan-1-one.
| Compound Name | trans-(2R,3S)-2-hexa-3,5-dienyl-3-pentylcyclopentan-1-one |
|---|---|
| PubChem CID | 57173392 |
| Molecular Formula | C16H26O |
| Molecular Weight | 234.38 g/mol |
| Exact Mass | 234.20 |
| IUPAC Name | trans-(2R,3S)-2-hexa-3,5-dienyl-3-pentylcyclopentan-1-one |
| SMILES | C=CC=CCC[C@H]1C(=O)CC[C@@H]1CCCCC |
| InChI | InChI=1S/C16H26O/c1-3-5-7-9-11-15-14(10-8-6-4-2)12-13-16(15)17/h3,5,7,14-15H,1,4,6,8-13H2,2H3/t14-,15+/m0/s1 |
| InChIKey | WSTQEHUWRDGJAN-LSDHHAIUSA-N |
| XLogP | 4.68 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.38 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|