C13H22O — CID 134987535
trans-(2S,3S)-2-pentyl-3-prop-2-enylcyclopentan-1-one (PubChem CID 134987535) has the molecular formula C13H22O and a molecular weight of 194.32 g/mol. Its IUPAC name is trans-(2S,3S)-2-pentyl-3-prop-2-enylcyclopentan-1-one.
| Compound Name | trans-(2S,3S)-2-pentyl-3-prop-2-enylcyclopentan-1-one |
|---|---|
| PubChem CID | 134987535 |
| Molecular Formula | C13H22O |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.17 |
| IUPAC Name | trans-(2S,3S)-2-pentyl-3-prop-2-enylcyclopentan-1-one |
| SMILES | C=CC[C@@H]1CCC(=O)[C@H]1CCCCC |
| InChI | InChI=1S/C13H22O/c1-3-5-6-8-12-11(7-4-2)9-10-13(12)14/h4,11-12H,2-3,5-10H2,1H3/t11-,12+/m1/s1 |
| InChIKey | WFTVCLXUXBTOPH-NEPJUHHUSA-N |
| XLogP | 3.74 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|